OID repository
OID Repository
https://oid-base.com
Display OID:
 
Tree display  
 
Separation line
 
  Unfolding the subtreeNode of the OID tree itu-t(0) | ccitt(0) | itu-r(0)   -- International Telecommunication...
  Folding the subtreeNode of the OID tree iso(1)   -- International Organization for Standardization (ISO)
  | Folding the subtreeNode of the OID tree standard(0)   -- ISO or IEC International Standards (not jointly...
  | | Unfolding the subtreeNode of the OID tree 639   -- Series of ISO 639 International Standards "Codes for...
  | | Unfolding the subtreeNode of the OID tree 1087   -- ISO 1087 series "Terminology work - Vocabulary"
  | | Unfolding the subtreeNode of the OID tree 2022   -- ISO/IEC 2022 "Information technology - Character code...
  | | Unfolding the subtreeNode of the OID tree 2382   -- ISO/IEC 2382 series "Information technology --...
  | | Unfolding the subtreeNode of the OID tree country-codes(3166)   -- ISO 3166 "Codes for the representation...
  | | |-Leaf of the OID tree iso4217(4217)   -- ISO 4217 "Currency Codes"
  | | Unfolding the subtreeNode of the OID tree sdtc(4426)   -- ISO 4426 "Intelligent transport systems — Lower...
  | | Unfolding the subtreeNode of the OID tree secure-multiparty-computation(4922)   -- ISO/IEC 4922...
  | | |-Leaf of the OID tree human-sexes(5218)   -- ISO/IEC 5218 "Information technology --...
  | | |-Leaf of the OID tree iso6523(6523)   -- ISO/IEC 6523 "Information technology --...
  | | Unfolding the subtreeNode of the OID tree 7498   -- ISO/IEC 7498 series "Information processing systems --...
  | | Unfolding the subtreeNode of the OID tree iso7816(7816) | ic-cards(7816)   -- ISO 7816 series "Information...
  | | Unfolding the subtreeNode of the OID tree iso8571(8571) | ftam(8571)   -- OSI (Open Systems...
  | | |-Leaf of the OID tree 8601   -- ISO 8601 "Data elements and interchange formats --...
  | | Unfolding the subtreeNode of the OID tree iso8802(8802)   -- ISO/IEC 8802 "Information technology --...
  | | Unfolding the subtreeNode of the OID tree vt-b(9040)   -- ISO/IEC 9040 "Information technology -- Open...
  | | Unfolding the subtreeNode of the OID tree iso9041(9041)   -- ISO/IEC 9041 series: Information technology...
  | | Unfolding the subtreeNode of the OID tree 9069   -- ISO 9069 "Information processing -- Standard...
  | | |-Leaf of the OID tree bic(9362)   -- ISO 9362 "Banking -- Banking telecommunication...
  | | Unfolding the subtreeNode of the OID tree iso9506(9506)   -- ISO 9506 multi-part standard: "Industrial...
  | | Unfolding the subtreeNode of the OID tree ips-osi-mips(9596)   -- ISO/IEC 9596 series "Information...
  | | Unfolding the subtreeNode of the OID tree signature-schemes(9796)   -- ISO/IEC 9796 "International...
  | | Unfolding the subtreeNode of the OID tree message-authentication-codes(9797)   -- ISO/IEC 9797...
  | | Unfolding the subtreeNode of the OID tree e-auth-mechanisms(9798)   -- ISO 9798 series "Information...
  | | Unfolding the subtreeNode of the OID tree 9834   -- ISO 9834 Series "Information technology -- Open...
  | | Unfolding the subtreeNode of the OID tree iso9979(9979)   -- ISO/IEC 9979 International Standard:...
  | | Unfolding the subtreeNode of the OID tree mess(9992) | iso9992(9992)   -- ISO/IEC 9992 series "Financial...
  | | Unfolding the subtreeNode of the OID tree mhs(10021)   -- ISO/IEC 10021ISO/IEC 10021 "Information...
  | | Unfolding the subtreeNode of the OID tree modes-of-operation(10116)   -- ISO/IEC 10116 "Information...
  | | Unfolding the subtreeNode of the OID tree hash-functions(10118)   -- ISO/IEC 10118 "Information technology...
  | | Unfolding the subtreeNode of the OID tree iso10161(10161)   -- ISO 10161 "Information and documentation --...
  | | Unfolding the subtreeNode of the OID tree 10166   -- ISO/IEC 10166 "International Standard: Information...
  | | |-Leaf of the OID tree 10374   -- International Standard ISO 10374: Freight containers...
  | | Unfolding the subtreeNode of the OID tree iso10646(10646)   -- ISO/IEC 10646 "Information technology --...
  | | Unfolding the subtreeNode of the OID tree 10746   -- ISO/IEC 10746 series "Information technology -- Open...
  | | |-Leaf of the OID tree 10891   -- ISO/TS 10891: Freight containers -- Radio frequency...
  | | Unfolding the subtreeNode of the OID tree iso11188(11188) | culr(11188) | x637(11188)   -- ISO/IEC 11188...
  | | |-Leaf of the OID tree 11404   -- ISO/IEC 11404 "Information technology -- Programming...
  | | Unfolding the subtreeNode of the OID tree rpc(11578)   -- ISO/IEC 11578:1996: Information technology --...
  | | Unfolding the subtreeNode of the OID tree pss1-generic-procedures(11582)   -- ISO/IEC 11582 "Generic...
  | | Unfolding the subtreeNode of the OID tree key-management(11770) | keyManagement(11770)   -- ISO/IEC 11770...
  | | Unfolding the subtreeNode of the OID tree 12813   -- ISO 12813 "Electronic fee collection -- Compliance...
  | | Unfolding the subtreeNode of the OID tree 12855   -- ISO 12855 "Electronic fee collection -- Information...
  | | Unfolding the subtreeNode of the OID tree 13141   -- ISO 13141 "Electronic fee collection -- Localisation...
  | | |-Leaf of the OID tree iban(13616)   -- ISO 13616 "Financial services -- International...
  | | Unfolding the subtreeNode of the OID tree pss1-name(13868)   -- ISO/IEC 13868 "Information technology --...
  | | Unfolding the subtreeNode of the OID tree pss1-call-transfer(13869)   -- ISO 13869 "Information technology...
  | | Unfolding the subtreeNode of the OID tree pss1-call-completion(13870)   -- ISO/IEC 13870 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-call-diversion(13873)   -- ISO/IEC 13873 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-path-replacement(13874)   -- ISO/IEC 13874 "Information...
  | | Unfolding the subtreeNode of the OID tree non-repudiation(13888)   -- ISO/IEC 13888 "Information...
  | | Unfolding the subtreeNode of the OID tree iso14813(14813)   -- ISO/TR 14813 "Transport Information and...
  | | Unfolding the subtreeNode of the OID tree iso14816(14816)   -- ISO 14816 "Road transport and traffic...
  | | Unfolding the subtreeNode of the OID tree gdd(14823)   -- ISO 14823 "Intelligent transport systems --...
  | | Unfolding the subtreeNode of the OID tree pss1-call-offer(14843)   -- ISO/IEC 14843 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-do-not-disturb(14844)   -- ISO/IEC 14844 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-call-intrusion(14846)   -- ISO/IEC 14846 "Information...
  | | Unfolding the subtreeNode of the OID tree digital-signature-with-appendix(14888) | ...   -- ISO/IEC 14888...
  | | Unfolding the subtreeNode of the OID tree 14906   -- ISO 14906 "Electronic fee collection -- Application...
  | | Unfolding the subtreeNode of the OID tree pss1-advice-of-charge(15050)   -- ISO/IEC 15050 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-recall(15052)   -- ISO/IEC 15052 "Information technology —...
  | | Unfolding the subtreeNode of the OID tree pss1-cint(15054)   -- ISO/IEC 15054 "Information technology —...
  | | Unfolding the subtreeNode of the OID tree 15118   -- ISO 15118 "Road vehicles — Vehicle to grid...
  | | Unfolding the subtreeNode of the OID tree 15418   -- ISO/IEC 15418:2009 "Information technology --...
  | | Unfolding the subtreeNode of the OID tree pss1-location-registration(15429)   -- ISO/IEC 15429...
  | | Unfolding the subtreeNode of the OID tree pss1-wtm-call-handling(15431)   -- ISO/IEC 15431 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-authentication(15433)   -- ISO/IEC 15433 "Information...
  | | |-Leaf of the OID tree 15434   -- ISO/IEC 15434 "Transfer Syntax for High Capacity data...
  | | Unfolding the subtreeNode of the OID tree 15459   -- ISO/IEC 15459 "Information technology -- Automatic...
  | | Unfolding the subtreeNode of the OID tree pss1-message-waiting-indication(15506)   -- ISO/IEC 15506...
  | | Unfolding the subtreeNode of the OID tree pinx-clock-synchronization(15507)   -- ISO/IEC 15507...
  | | Unfolding the subtreeNode of the OID tree dsrc(15628)   -- ISO 15628 "Road transport and traffic...
  | | Unfolding the subtreeNode of the OID tree pss1-common-information(15772)   -- ISO/IEC 15772 "Information...
  | | Unfolding the subtreeNode of the OID tree elliptic-curves(15946)   -- ISO/IEC 15946 "Information...
  | | Unfolding the subtreeNode of the OID tree rfid-data-protocol(15961)   -- ISO/IEC 15961 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-call-interruption(15992)   -- ISO/IEC 15992 "Information...
  | | Unfolding the subtreeNode of the OID tree localized(16460)   -- ISO/TS 16460 "Intelligent transport...
  | | Unfolding the subtreeNode of the OID tree 16785   -- ISO/TS 16785 "Electronic Fee Collection (EFC) --...
  | | Unfolding the subtreeNode of the OID tree hcpki(17090)   -- ISO 17090 "Health informatics -- Public key...
  | | Unfolding the subtreeNode of the OID tree iso17262(17262)   -- ISO 17262 "Intelligent transport systems --...
  | | Unfolding the subtreeNode of the OID tree iso17264(17264)   -- ISO 17264 "Intelligent transport systems --...
  | | Unfolding the subtreeNode of the OID tree cits-applMgmt(17419)   -- ISO 17419 "Intelligent transport...
  | | Unfolding the subtreeNode of the OID tree cits-applReq(17423)   -- ISO/TS 17423 "Intelligent Transport...
  | | Unfolding the subtreeNode of the OID tree itssf(17429)   -- ISO/TS 17429 "Intelligent Transport Systems...
  | | Unfolding the subtreeNode of the OID tree inavi(17438)   -- ISO 17438-1 "Intelligent Transport Systems...
  | | Unfolding the subtreeNode of the OID tree lte(17515)   -- ISO 17515 "Intelligent transport systems —...
  | | Unfolding the subtreeNode of the OID tree 17573   -- ISO 17573 "Electronic fee collection — Systems...
  | | Unfolding the subtreeNode of the OID tree 17575   -- ISO TS 17575: Road Transport and Traffic Telematics...
  | | Unfolding the subtreeNode of the OID tree pss1-pum-registration(17876)   -- ISO/IEC 17876 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-pum-call-handling(17878)   -- ISO/IEC 17878 "Information...
  | | Unfolding the subtreeNode of the OID tree bhsm(17922)   -- Rec. ITU-T X.1085 | ISO/IEC 17922 "Information...
  | | Unfolding the subtreeNode of the OID tree driving-licence(18013)   -- ISO/IEC 18013 series "Personal...
  | | Unfolding the subtreeNode of the OID tree tss(18014) | time-stamp(18014)   -- ISO/IEC 18014 "Information...
  | | |-Leaf of the OID tree random-bit-generation(18031)   -- ISO/IEC 18031 "Information...
  | | |-Leaf of the OID tree prime-number-generation(18032)   -- ISO/IEC 18032 "Information...
  | | Unfolding the subtreeNode of the OID tree encryption-algorithms(18033) | is18033(18033)   -- ISO/IEC 18033...
  | | Unfolding the subtreeNode of the OID tree blind-digital-signatures-mechanisms(18370)   -- ISO/IEC 18370...
  | | Unfolding the subtreeNode of the OID tree cits-ldm(18750)   -- ISO/TS 18750 "Intelligent transport systems...
  | | Unfolding the subtreeNode of the OID tree six-lowpan(19079)   -- ISO 19079 "Intelligent transport systems...
  | | Unfolding the subtreeNode of the OID tree signalizedIntersection(19091)   -- ISO/TS 19091 "Intelligent...
  | | Unfolding the subtreeNode of the OID tree ivi(19321)   -- ISO/TS 19321 "Intelligent Transport Systems...
  | | Unfolding the subtreeNode of the OID tree pss1-single-step-call-transfer(19460)   -- ISO/IEC 19460...
  | | Unfolding the subtreeNode of the OID tree secret-sharing(19592)   -- ISO/IEC 19592 "Information technology...
  | | Unfolding the subtreeNode of the OID tree authenticated-encryption(19772)   -- ISO/IEC 19772 "Information...
  | | Unfolding the subtreeNode of the OID tree cbeff(19785)   -- ISO/IEC 19785: Information Technology --...
  | | Unfolding the subtreeNode of the OID tree 19794   -- ISO/IEC 19794 series "Information technology --...
  | | Unfolding the subtreeNode of the OID tree anonymous-digital-signatures(20008)   -- ISO/IEC 20008...
  | | Unfolding the subtreeNode of the OID tree anonymous-entity-authentication(20009) | ...   -- ISO/IEC 20009 series...
  | | |-Leaf of the OID tree unifi(20022)   -- ISO 20022 "Universal Financial Industry...
  | | Unfolding the subtreeNode of the OID tree 20248   -- ISO/IEC 20248 "Automatic identification and data...
  | | Unfolding the subtreeNode of the OID tree 20684   -- ISO 20684 series "Intelligent transport systems —...
  | | Folding the subtreeNode of the OID tree scm-standard(20828)   -- ASN.1 module named...
  | | | |-Leaf of the OID tree scm-inList(1)   -- "scm-inList"
  | | | |-Leaf of the OID tree scm-exList(2)   -- j"scm-exList"
  | | | |-Leaf of the OID tree scm-vin(3)   -- "scm-vin"
  | | | -Leaf of the OID tree scm-pathInformation(4)   -- "scm-pathInformation"
  | | Unfolding the subtreeNode of the OID tree 21000   -- ISO/IEC 21000 series "Information technology --...
  | | Unfolding the subtreeNode of the OID tree 21091   -- ISO 21091 "Health informatics -- Directory services...
  | | Unfolding the subtreeNode of the OID tree pvt(21176)   -- ISO/TS 21176 "Cooperative Intelligent Transport...
  | | Unfolding the subtreeNode of the OID tree its-s-secure-session(21177)   -- ISO TS 21177 "Intelligent...
  | | Unfolding the subtreeNode of the OID tree gtdm(21184)   -- ISO TS 21184 "Cooperative Intelligent Transport...
  | | Unfolding the subtreeNode of the OID tree cptd21185(21185)   -- ISO/TS 21185 "Intelligent transport...
  | | Unfolding the subtreeNode of the OID tree 21192   -- ISO TS 21192 "Electronic fee collection -- Support...
  | | Unfolding the subtreeNode of the OID tree 21193   -- ISO/TS 21193 "Electronic Fee Collection (EFC) --...
  | | Unfolding the subtreeNode of the OID tree its-ipv6(21210)   -- ISO 21210 "Intelligent transport systems --...
  | | Unfolding the subtreeNode of the OID tree calm-m5(21215)   -- ISO 21215 "Intelligent transport systems —...
  | | Unfolding the subtreeNode of the OID tree calm-ll-sap(21218)   -- ISO 21218 "Intelligent transport systems...
  | | Unfolding the subtreeNode of the OID tree pss1-simple-dialog(21407)   -- ISO/IEC 21407 "Information...
  | | Unfolding the subtreeNode of the OID tree pss1-call-identification-and-call-linkage(21889)   -- ISO/IEC...
  | | Unfolding the subtreeNode of the OID tree fsap(22418)   -- ISO 22418 "Intelligent transport systems — Fast...
  | | Unfolding the subtreeNode of the OID tree occ(22738)   -- ISO 22738 "Intelligent transport systems —...
  | | Unfolding the subtreeNode of the OID tree css(22895)   -- ISO 22895 "Financial services - Security -...
  | | Unfolding the subtreeNode of the OID tree redaction-of-authentic-data(23264)   -- ISO/IEC 23264...
  | | Unfolding the subtreeNode of the OID tree calm-management(24102)   -- ISO 24102 "Intelligent transport...
  | | Unfolding the subtreeNode of the OID tree cz(24311)   -- ISO 24311 "Intelligent transport systems --...
  | | |-Leaf of the OID tree 24531   -- ISO 24531 "Intelligent Transport Systems (ITS) --...
  | | Unfolding the subtreeNode of the OID tree iso24534(24534)   -- ISO 24534 "Automatic vehicle and equipment...
  | | Unfolding the subtreeNode of the OID tree iso24727(24727)   -- ISO/IEC 24727 "Identification cards --...
  | | Unfolding the subtreeNode of the OID tree 24753   -- ISO/IEC 24753 "Information technology -- Radio...
  | | Unfolding the subtreeNode of the OID tree acbio(24761)   -- ISO/IEC 24761 "Information technology --...
  | | |-Leaf of the OID tree 24787   -- ISO/IEC 24787 "Information technology --...
  | | Unfolding the subtreeNode of the OID tree signcryption(29150)   -- ISO/IEC 29150 "Information technology...
  | | Unfolding the subtreeNode of the OID tree lightweight-cryptography(29192)   -- ISO/IEC 29192-4...
  | | Unfolding the subtreeNode of the OID tree calm-nonip(29281)   -- ISO 29281 "Intelligent transport systems...
  | | Unfolding the subtreeNode of the OID tree 30107   -- ISO/IEC 30107 "Information technology -- Biometric...
  | | Unfolding the subtreeNode of the OID tree iso-iec-39794(39794)   -- ISO/IEC 39794 series "Information...
  | | Unfolding the subtreeNode of the OID tree stdx61375(61375)   -- IEC 61375-1 "Electronic railway equipment...
  | | Unfolding the subtreeNode of the OID tree iec62351(62351)   -- IEC 62351 "Power systems management and...
  | | Unfolding the subtreeNode of the OID tree iec62379(62379)   -- IEC 62379 series "Common control interface...
  | | Unfolding the subtreeNode of the OID tree iec62439(62439)   -- IEC 62439 "Industrial communication...
  | | Unfolding the subtreeNode of the OID tree listmode-dataformat(63047)   -- IEC 63047 "Nuclear...
  | | -Leaf of the OID tree ses4hit(81001)   -- ISO 81001 "Health software and health...
  | Unfolding the subtreeNode of the OID tree registration-authority(1)   -- Registration authorities
  | Folding the subtreeNode of the OID tree member-body(2)   -- ISO Member Bodies
  | | Unfolding the subtreeNode of the OID tree au(36)   -- Australia
  | | Unfolding the subtreeNode of the OID tree at(40)   -- Austria
  | | Unfolding the subtreeNode of the OID tree be(56)   -- Belgium
  | | |-Leaf of the OID tree ca(124)   -- Canada
  | | Unfolding the subtreeNode of the OID tree cn(156)   -- People's Republic of China
  | | Folding the subtreeNode of the OID tree cz(203)   -- Czech Republic
  | | | Unfolding the subtreeNode of the OID tree mzcr(24341)   -- Ministry of health of the Czech Republic (in...
  | | | |-Leaf of the OID tree eIdentity(27112489)   -- eIdentity a.s.
  | | | -Leaf of the OID tree 48135283   -- Czech Standards Institute
  | | Unfolding the subtreeNode of the OID tree dk(208)   -- Denmark
  | | Unfolding the subtreeNode of the OID tree fi(246)   -- Finland
  | | Unfolding the subtreeNode of the OID tree fr(250)   -- France
  | | Folding the subtreeNode of the OID tree de(276)   -- Germany
  | | | Folding the subtreeNode of the OID tree din-certco(0)   -- Organizations
  | | |   Unfolding the subtreeNode of the OID tree allgemein(0)   -- General
  | | |   |-Leaf of the OID tree innomed(14)   -- General Electric (GE) Healthcare...
  | | |   |-Leaf of the OID tree aycanpacs(16)   -- Aycan Digitalsysteme GmbH
  | | |   |-Leaf of the OID tree 20   -- BrainLAB AG
  | | |   |-Leaf of the OID tree tzmi(23)   -- "NEXUS / CHILI GmbH"
  | | |   |-Leaf of the OID tree mevis(28)   -- MeVis Medical Solutions AG (formerly, MeVis,...
  | | |   |-Leaf of the OID tree m3i(30)   -- Medical Communications GmbH
  | | |   |-Leaf of the OID tree medigration(33)   -- Medigration GmbH
  | | |   |-Leaf of the OID tree gedimed(36)   -- Gedimed Gesellschaft für Dienstleistungen...
  | | |   |-Leaf of the OID tree medavis(37)   -- Medavis GmbH
  | | |   |-Leaf of the OID tree gwi(40)   -- Dedalus HealthCare GmbH
  | | |   |-Leaf of the OID tree integration(43)   -- Integration AG
  | | |   Unfolding the subtreeNode of the OID tree 44   -- TC TrustCenter GmbH
  | | |   |-Leaf of the OID tree sohard-dicom(45)   -- Visage Imaging GmbH
  | | |   |-Leaf of the OID tree mediweb(48)   -- TomTec Imaging Systems GmbH
  | | |   |-Leaf of the OID tree ad(49)   -- Swiss Life Deutschland Operations GmbH
  | | |   |-Leaf of the OID tree jivex(50)   -- "VISUS Health IT GmbH"
  | | |   |-Leaf of the OID tree dorniermedtech(52)   -- Dornier MedTech Systems GmbH
  | | |   |-Leaf of the OID tree medcom(55)   -- MedCom Gesellschaft für medizinische...
  | | |   |-Leaf of the OID tree duria(58)   -- Duria Datenverarbeitungsgenossenschaft für...
  | | |   |-Leaf of the OID tree medidok(64)   -- mediDOK Software Entwicklungsges. mbH
  | | |   |-Leaf of the OID tree bund(66)   -- Bundesanstalt für den Digitalfunk der Behörden...
  | | |   |-Leaf of the OID tree storz(67)   -- Karl Storz SE & Co. KG
  | | |   |-Leaf of the OID tree infineon(68)   -- Infineon Technologies IT Services GmbH
  | | |   |-Leaf of the OID tree imagediagnost(69)   -- General Electric (GE) Healthcare GmbH
  | | |   |-Leaf of the OID tree uhde(72)   -- ThyssenKrupp Industrial Solutions AG
  | | |   |-Leaf of the OID tree meierhofer(73)   -- Meierhofer AG
  | | |   |-Leaf of the OID tree curasystems(74)   -- curasystems GmbH
  | | |   |-Leaf of the OID tree carlzeiss(75)   -- Carl Zeiss Meditec AG
  | | |   Folding the subtreeNode of the OID tree gesundheitswesen(76)   -- Bundesinstitut für Arzneimittel...
  | | |   | |-Leaf of the OID tree dimdi(2)   -- German Institute of Medical Documentation...
  | | |   | Unfolding the subtreeNode of the OID tree instanzen-identifikatoren(3)   -- Organizations and persons
  | | |   | Unfolding the subtreeNode of the OID tree identifizierungsmechanismen(4)   -- Identification...
  | | |   | Folding the subtreeNode of the OID tree kodierschema(5)   -- Code scheme (in German, Kodierschema)
  | | |   | | |-Leaf of the OID tree s-kts-ebs(18)   -- List of data recipients, who are...
  | | |   | | |-Leaf of the OID tree codesystem-74(74)   -- ICD10 codes (categories) for...
  | | |   | | |-Leaf of the OID tree codesystem-76(76)   -- Type of accident (in German,...
  | | |   | | |-Leaf of the OID tree codesystem-78(78)   -- Intoxications, alcohol, drugs...
  | | |   | | |-Leaf of the OID tree codesystem-79(79)   -- Procedures (traumatology) (in...
  | | |   | | |-Leaf of the OID tree codesystem-80(80)   -- Injury Severity (traumatology)...
  | | |   | | |-Leaf of the OID tree codesystem-81(81)   -- Injury Body Regions...
  | | |   | | |-Leaf of the OID tree codesystem-82(82)   -- "NACA" score
  | | |   | | |-Leaf of the OID tree codesystem-83(83)   -- Anticoagulant (traumatology) (in...
  | | |   | | |-Leaf of the OID tree codesystem-84(84)   -- Cause of death (traumatology) (in...
  | | |   | | |-Leaf of the OID tree codesystem-85(85)   -- Disposition (traumatology) (in...
  | | |   | | |-Leaf of the OID tree codesystem-86(86)   -- Emergency admitting team (in...
  | | |   | | |-Leaf of the OID tree codesystem-87(87)   -- "ASA" physical status...
  | | |   | | |-Leaf of the OID tree codesystem-90(90)   -- Approach Site (central venous...
  | | |   | | |-Leaf of the OID tree codesystem-91(91)   -- Approach Site (arterial) (in...
  | | |   | | |-Leaf of the OID tree codesystem-92(92)   -- Fracture treatment method (in...
  | | |   | | |-Leaf of the OID tree s-kbv-dokumenttyp(100)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-ita-dokumentbeziehung(101)   -- German internal...
  | | |   | | |-Leaf of the OID tree s-ita-datenempfaenger(102)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-ita-datenerzeuger(103)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-ita-datensender(104)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kbv-personfunktion(105)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree geltungsbereich(106)   -- Tabelle in der alle...
  | | |   | | |-Leaf of the OID tree s-kbv-geltungsbereich(107)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kbv-bearbeitungszustand(108)   -- German internal...
  | | |   | | |-Leaf of the OID tree s-kbv-schnittstelle(109)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree pruefcodes(110)   -- German internal specific parameter...
  | | |   | | |-Leaf of the OID tree s-kbv-stichprobe(113)   -- German specific billing...
  | | |   | | |-Leaf of the OID tree s-bar2-wbo(114)   -- German internal specific parameter...
  | | |   | | |-Leaf of the OID tree s-ebm-Arztgruppe(115)   -- German physician group...
  | | |   | | |-Leaf of the OID tree gebuehrenpflicht(117)   -- German specific billing...
  | | |   | | |-Leaf of the OID tree 118   -- ABDA-Routes (description for routes of...
  | | |   | | |-Leaf of the OID tree s-ast-versichertenstatus(221)   -- German covered party...
  | | |   | | |-Leaf of the OID tree s-kbv-personengruppe(222)   -- German person group...
  | | |   | | |-Leaf of the OID tree s-kbv-dmp(223)   -- German specific billing parameter...
  | | |   | | |-Leaf of the OID tree gebuehrenpflicht-eGK(224)   -- German specific billing...
  | | |   | | |-Leaf of the OID tree s-kbv-rechtskreis(225)   -- German specific billing...
  | | |   | | |-Leaf of the OID tree s-ebm-bezugsraum(226)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-ebm-leistungsgruppe(227)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-ebm-profilzeitart(228)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-ebm-zusatzangabe(229)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kbv-bezirksstelle(230)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kbv-gebuehrenordnung(231)   -- German specific billing...
  | | |   | | |-Leaf of the OID tree s-kbv-geschlecht(232)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kbv-kv(233)   -- German internal specific parameter...
  | | |   | | |-Leaf of the OID tree s-kbv-leistungserbringart(234)   -- German internal...
  | | |   | | |-Leaf of the OID tree s-kbv-scheinart(235)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kbv-valuteinheit(236)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kbv-versorgungsbereich(237)   -- German internal...
  | | |   | | |-Leaf of the OID tree s-kbv-zeiteinheit(238)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-kts-ktabrechnungsbereich(239)   -- German specific...
  | | |   | | |-Leaf of the OID tree s-kts-ktgruppe(240)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-ebm-rlv(241)   -- German internal specific parameter...
  | | |   | | |-Leaf of the OID tree s-ebm-schnittnahtzeit(242)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-fao-icpm(243)   -- German internal specific parameter...
  | | |   | | |-Leaf of the OID tree s-EBM-VB2WBO(244)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree bTM-Kennzeichen(245)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree medikation-Art(246)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree packungsgroesse(248)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree qualifizierung-Arzneimittel(249)   -- German internal...
  | | |   | | |-Leaf of the OID tree dosierung-Tageszeit(250)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree datenannahmestelle-DMP(251)   -- German internal...
  | | |   | | |-Leaf of the OID tree originating-organization-type-cd(252)   -- German...
  | | |   | | |-Leaf of the OID tree caption-cd(253)   -- German internal specific parameter...
  | | |   | | |-Leaf of the OID tree parameter(254)   -- German internal specific parameter...
  | | |   | | |-Leaf of the OID tree parameter-au(255)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree caption-cd-au(256)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-vdx-vertragsart(257)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree s-vdx-kontenart(258)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree berichtspflicht(259)   -- German internal specific...
  | | |   | | |-Leaf of the OID tree actCodeDE(260)   -- In German: Deutsche Erweiterungen...
  | | |   | | |-Leaf of the OID tree ops301v2004(301)   -- German procedure classification...
  | | |   | | |-Leaf of the OID tree icd10gm2004(302)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2005(303)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree icd10gm2005(304)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree id-macs(305)   -- Nomenclature based on the work of...
  | | |   | | |-Leaf of the OID tree standardTermsG(306)   -- National Dictionary of Dosage...
  | | |   | | |-Leaf of the OID tree askBezVO(308)   -- In German: ASK-Nummer der...
  | | |   | | |-Leaf of the OID tree alphaid2006(309)   -- ID of the Alpha-ID 2006...
  | | |   | | |-Leaf of the OID tree ops2006(310)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree icd10gm2006(311)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree begriffsmolekuele(312)   -- Easily readable, multiaxial...
  | | |   | | |-Leaf of the OID tree versicherungskartenparameter(313)   -- Insurance...
  | | |   | | |-Leaf of the OID tree versicherungskartentyp(314)   -- Table containing all...
  | | |   | | |-Leaf of the OID tree versicherungskartenzuzahlungskennzeichen(315)   -- ...
  | | |   | | |-Leaf of the OID tree alphaid2007(316)   -- ID of the alphabetical Index...
  | | |   | | |-Leaf of the OID tree ops2007(317)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree icd10gm2007(318)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree atcgm2006(319)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcgm2007(320)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree s-kbv-dialyseverfahren(321)   -- Codes to mark the type...
  | | |   | | |-Leaf of the OID tree s-kbv-therapiestatus(322)   -- Contains codes to mark...
  | | |   | | |-Leaf of the OID tree s-kbv-dialyseform(323)   -- Codes to mark the location...
  | | |   | | |-Leaf of the OID tree s-kbv-dialyseabbruchgrund(324)   -- Contains codes for...
  | | |   | | |-Leaf of the OID tree s-kbv-grunderkrankung(325)   -- Codes for the indication...
  | | |   | | |-Leaf of the OID tree s-kts-wop(326)   -- In German: Prinzipien hinsichtlich...
  | | |   | | |-Leaf of the OID tree s-KBV-RSASTATUS(327)   -- Table wich german specific...
  | | |   | | |-Leaf of the OID tree praeparateabbildung(328)   -- Identification mechanism...
  | | |   | | |-Leaf of the OID tree alphaid2008(329)   -- ID of the alphabetical Index...
  | | |   | | |-Leaf of the OID tree icd10gm2008(330)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2008(331)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree atcgm2008(332)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree s-KBV-BEIHILFE(333)   -- Table with german specific...
  | | |   | | |-Leaf of the OID tree tumordiagnosen(334)   -- Codes that represent different...
  | | |   | | |-Leaf of the OID tree dignitaet-tumor(335)   -- Characteristic of the tumor...
  | | |   | | |-Leaf of the OID tree diff-grading-tumor(336)   -- Grading and differentiation...
  | | |   | | |-Leaf of the OID tree ausdehnung-tnm(337)   -- T-Code TNM (in German, T-Kode...
  | | |   | | |-Leaf of the OID tree nodus-tnm(338)   -- N-Code TNM (in German, N-Kode TNM)
  | | |   | | |-Leaf of the OID tree metastasen-tnm(339)   -- M-Code TNM (in German, M-Kode...
  | | |   | | |-Leaf of the OID tree tnm-qualifier(340)   -- Descriptor TNM Qaulifier (in...
  | | |   | | |-Leaf of the OID tree c-faktor-tumor(341)   -- Certainty of Observation (in...
  | | |   | | |-Leaf of the OID tree typisierung-diagnose(342)   -- Types of Diagnosis....
  | | |   | | |-Leaf of the OID tree dsmIVde(343)   -- DSM IV Diagnostic and Statistical...
  | | |   | | |-Leaf of the OID tree ktl2007(344)   -- Classification of therapeutical...
  | | |   | | |-Leaf of the OID tree goz(345)   -- Invoice item following the so called GOZ...
  | | |   | | |-Leaf of the OID tree goae2002(346)   -- Invoice item following the so called...
  | | |   | | |-Leaf of the OID tree arzneimittelteilbarkeit(347)   -- Identifies the...
  | | |   | | |-Leaf of the OID tree ebm2008q1(348)   -- EBM 1/2008. German specific...
  | | |   | | |-Leaf of the OID tree ebm2008q2(349)   -- EBM 2/2008. German specific...
  | | |   | | |-Leaf of the OID tree ebm2008q3(350)   -- EBM 3/2008. German specific...
  | | |   | | |-Leaf of the OID tree ebm2008q4(351)   -- EBM 4/2008. German specific...
  | | |   | | |-Leaf of the OID tree uvgoae2007(352)   -- UV-GOAE 2007 Invoice item following...
  | | |   | | |-Leaf of the OID tree ebm-teilleistungsbezeichnungen(353)   -- German specific...
  | | |   | | |-Leaf of the OID tree ebm-teilleistungsbezeichnungen-anhang1(354)   -- German...
  | | |   | | |-Leaf of the OID tree alphaid2009(355)   -- ID of the alphabetical Index...
  | | |   | | |-Leaf of the OID tree icd10gm2009(356)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2009(357)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree atcgm2009(358)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree sozopsg(359)   -- Coding system of the "social workers'...
  | | |   | | |-Leaf of the OID tree ktl-dauer(360)   -- Period of therapeutical benefits in...
  | | |   | | |-Leaf of the OID tree ktl-anzahl(361)   -- Number of therapeutical benefits...
  | | |   | | |-Leaf of the OID tree drv-abteilungscodes(362)   -- Key of units of medical...
  | | |   | | |-Leaf of the OID tree ambulanter-Aufenthalt(363)   -- Specific code of sojourn...
  | | |   | | |-Leaf of the OID tree drv-entlassungsform(364)   -- Code of discharge in...
  | | |   | | |-Leaf of the OID tree drv-ebgliederung(365)   -- Code of sections of...
  | | |   | | |-Leaf of the OID tree drv-arbeitsfaehigkeit(366)   -- Working ability at the...
  | | |   | | |-Leaf of the OID tree drv-behandlungsergebniss(367)   -- Diagnostic result of...
  | | |   | | |-Leaf of the OID tree drv-krankheitsursache(368)   -- Reason of disease (first...
  | | |   | | |-Leaf of the OID tree drv-auzeiten(369)   -- disability during the last 12...
  | | |   | | |-Leaf of the OID tree drv-dmp(370)   -- Specific code of participation on DMP...
  | | |   | | |-Leaf of the OID tree drv-empfehlungen(371)   -- Aftercare regards (in German,...
  | | |   | | |-Leaf of the OID tree drv-zeitumfang(372)   -- Timecode of reduction in...
  | | |   | | |-Leaf of the OID tree 373   -- Code of positiv and negativ capacity (in...
  | | |   | | |-Leaf of the OID tree s-ebm-ow-versorgungsgebiet(374)   -- German specific...
  | | |   | | |-Leaf of the OID tree icd10gm2007-populaer(375)   -- Bertelsmann-Stiftung's...
  | | |   | | |-Leaf of the OID tree ops2007-populaer(376)   -- Bertelsmann-Stiftung's...
  | | |   | | |-Leaf of the OID tree icd10gm2008-populaer(377)   -- Bertelsmann-Stiftung's...
  | | |   | | |-Leaf of the OID tree ops2008-populaer(378)   -- Bertelsmann-Stiftung's...
  | | |   | | |-Leaf of the OID tree alphaid2010(383)   -- ICD-10-GM-2010 alphabetical index
  | | |   | | |-Leaf of the OID tree icd10gm2010(384)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2010(385)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree atcgm2010(386)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree alphaid2011(387)   -- ID of the alphabetical Index...
  | | |   | | |-Leaf of the OID tree icd10gm2011(388)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2011(389)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree atcgm2011(390)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree 391   -- LEP Nursing 3 ia a terminolgy for the...
  | | |   | | |-Leaf of the OID tree european-nursing-care-pathway(407)   -- ENP (European...
  | | |   | | |-Leaf of the OID tree alphaid2012(408)   -- ID of the alphabetical Index...
  | | |   | | |-Leaf of the OID tree icd10gm2012(409)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2012(410)   -- German procedure classification...
  | | |   | | |-Leaf of the OID tree atcgm2012(411)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree codesystem-412(412)   -- Laterality (in German,...
  | | |   | | |-Leaf of the OID tree icd10gm2013(413)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2013(414)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree alphaid2013(415)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree atcgm2013(416)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree icd10gm2014(417)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2014(418)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree alphaid2014(419)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree atcgm2014(420)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree abdata-stoffkatalog(421)   -- 'ABDATA-Stoffkatalog', a...
  | | |   | | |-Leaf of the OID tree alphaid-se-muster2014(422)   -- Sample data set for a...
  | | |   | | |-Leaf of the OID tree kodierschema-423(423)   -- Vaccines (in German,...
  | | |   | | |-Leaf of the OID tree icd10gm2015(424)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2015(425)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree alphaid2015(426)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree atcgm2015(427)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree alphaid-se2015(428)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree alphaid-se-muster2015(429)   -- Sample data set for a...
  | | |   | | |-Leaf of the OID tree icd10gm2016(430)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2016(431)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree alphaid2016(432)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree alphaid-se2016(433)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree alphaid-se-muster2016(434)   -- Sample data set for a...
  | | |   | | |-Leaf of the OID tree atcgm2016(435)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree le-selvertr-tvz(436)   -- XML pattern for data exchange...
  | | |   | | |-Leaf of the OID tree emergencyseverityindex(437)   -- Emergency Severity Index
  | | |   | | |-Leaf of the OID tree manchestertriagesystem(438)   -- Manchester-Triage-System
  | | |   | | |-Leaf of the OID tree cedis(439)   -- CEDIS (Canadian Emergency Department...
  | | |   | | |-Leaf of the OID tree zuweiser(440)   -- Type of patient referral, e.g. for...
  | | |   | | |-Leaf of the OID tree codesystem-441(441)   -- Significant pathogen organisms...
  | | |   | | |-Leaf of the OID tree atcwido1995(442)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido1996(443)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido1997(444)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido1998(445)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido1999(446)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2000(447)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2001(448)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2002(449)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2003(450)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2004(451)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2005(452)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2006(453)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2007(454)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2008(455)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2009(456)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2010(457)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2011(458)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2012(459)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2013(460)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2014(461)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2015(462)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree icd10gm2017(463)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2017(464)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree alphaid2017(465)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree alphaid-se2017(466)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree alphaid-se-muster2017(467)   -- Sample data set for a...
  | | |   | | |-Leaf of the OID tree atcgm2017(468)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree einnahmehinweise(469)   -- Standardized reference sets...
  | | |   | | |-Leaf of the OID tree dosiereinheiten(470)   -- Standardised dosing units for...
  | | |   | | |-Leaf of the OID tree icd10gm2018(471)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2018(472)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree alphaid2018(473)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree alphaid-se2018(474)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree alphaid-se-muster2018(475)   -- Sample data set for a...
  | | |   | | |-Leaf of the OID tree atcgm2018(476)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree icd10gm2019(477)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2019(478)   -- German procedure classification OPS...
  | | |   | | |-Leaf of the OID tree alphaid2019(479)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree alphaid-se2019(480)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree alphaid-se-muster2019(481)   -- Sample data set for a...
  | | |   | | |-Leaf of the OID tree atcgm2019(482)   -- Anatomical Therapeutic Chemical...
  | | |   | | Unfolding the subtreeNode of the OID tree lep-classification(483)   -- LEP-classification for...
  | | |   | | |-Leaf of the OID tree s-kbv-statuskennzeichen(484)   -- Status code...
  | | |   | | |-Leaf of the OID tree berufsgruppen-ghcs(485)   -- Professional categories...
  | | |   | | |-Leaf of the OID tree icd10gm2020(486)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2020(487)   -- German procedure classification "OPS"...
  | | |   | | |-Leaf of the OID tree alphaid2020(488)   -- ID of the entries of the...
  | | |   | | |-Leaf of the OID tree alphaid-se2020(489)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree atcgm2020(490)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree epa-vertraulichkeit(491)   -- Confidentiality level for...
  | | |   | | |-Leaf of the OID tree qualifikationen-zahnaerztlicher-autoren(492)   -- ...
  | | |   | | |-Leaf of the OID tree aerztliche-berufsvarianten(493)   -- Medical profession...
  | | |   | | |-Leaf of the OID tree zahnaerztliche-fachrichtungen(494)   -- Dental...
  | | |   | | |-Leaf of the OID tree atcwido2016(495)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2017(496)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2018(497)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree atcwido2019(498)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree wingert-nomenklatur(499)   -- Comprehensive medical...
  | | |   | | |-Leaf of the OID tree codesystem-500(500)   -- Laboratory Structure (in...
  | | |   | | |-Leaf of the OID tree alphaid-se-muster2020(501)   -- Sample data set for a...
  | | |   | | |-Leaf of the OID tree icd10gm2021(502)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2021(503)   -- German procedure classification...
  | | |   | | |-Leaf of the OID tree alphaid2021(504)   -- Alphabetical Index ICD-10-GM-2021,...
  | | |   | | |-Leaf of the OID tree alphaid-se2021(505)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree atcgm2021(506)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree kdl-2019(507)   -- Clinical document class list used to...
  | | |   | | |-Leaf of the OID tree miv-medikationsrelevante-individualparameter(508)   -- ...
  | | |   | | |-Leaf of the OID tree kdl-2020(509)   -- Clinical document class list...
  | | |   | | |-Leaf of the OID tree atcwido2020(510)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree specialty-med(511)   -- Code system for medical...
  | | |   | | |-Leaf of the OID tree specialty-oth(512)   -- Code system for other categories...
  | | |   | | |-Leaf of the OID tree collectiontypes(513)   -- Code system for Categories of...
  | | |   | | |-Leaf of the OID tree facharzttitel-aerztekammern(514)   -- Code system for...
  | | |   | | |-Leaf of the OID tree enp2020(515)   -- European Nursing care Pathway (ENP)
  | | |   | | |-Leaf of the OID tree bass(517)   -- Basic Nursing Assessment, a structured...
  | | |   | | |-Leaf of the OID tree icd10gm2022(518)   -- International Statistical...
  | | |   | | |-Leaf of the OID tree ops2022(519)   -- German procedure classification...
  | | |   | | |-Leaf of the OID tree alphaid2022(520)   -- Alphabetical Index ICD-10-GM-2022,...
  | | |   | | |-Leaf of the OID tree alphaid-se2022(521)   -- Data set for a consistent and...
  | | |   | | |-Leaf of the OID tree atcgm2022(522)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree kdl-2021(523)   -- Clinical document class list 2021 (in...
  | | |   | | |-Leaf of the OID tree codesystem-524(524)   -- List of the identifier types of...
  | | |   | | |-Leaf of the OID tree atcwido2021(525)   -- Anatomical Therapeutic Chemical...
  | | |   | | |-Leaf of the OID tree cs-anlage-8-laenderkennzeichen(526)   -- Country code...
  | | |   | | |-Leaf of the OID tree gender-amtlich-de(527)   -- Codes for registration of...
  | | |   | | -Leaf of the OID tree merkzeichen-de(528)   -- Codes added to the German...
  | | |   | Unfolding the subtreeNode of the OID tree dokumente(7)   -- Documents
  | | |   | Unfolding the subtreeNode of the OID tree templates(10)   -- Templates
  | | |   | Unfolding the subtreeNode of the OID tree value-sets(11)   -- value-sets
  | | |   |-Leaf of the OID tree bundesdruckerei(80)   -- Bundesdruckerei GmbH
  | | |   |-Leaf of the OID tree duerr-dental-1(82)   -- DüRR Dental AG
  | | |   |-Leaf of the OID tree gn-Klin-hb-ost(83)   -- Gesundheit Nord gGmbH Klinikverbund...
  | | |   |-Leaf of the OID tree kvmasc(85)   -- "KV-IT" GmbH IT-Gesellschaft für integrierte...
  | | |   |-Leaf of the OID tree elmedical(87)   -- "NEXUS / E&L medical systems GmbH"
  | | |   |-Leaf of the OID tree studyiuid-grn(89)   -- Gesundheitszentren Rhein-Neckar (GRN)...
  | | |   |-Leaf of the OID tree ntbxray(90)   -- NTB elektronische Geräte GmbH
  | | |   |-Leaf of the OID tree compuGROUP(94)   -- CompuGROUP Medical Deutschland AG
  | | |   |-Leaf of the OID tree arztundpraxis(95)   -- EXAMION GmbH
  | | |   |-Leaf of the OID tree fysicon(98)   -- Fysicon B.V.
  | | |   |-Leaf of the OID tree fiagon-navigation(100)   -- Fiagon GmbH
  | | |   |-Leaf of the OID tree elcat(102)   -- ELCAT Gesellschaft für Industrie-und...
  | | |   |-Leaf of the OID tree maquet(103)   -- "MAQUET GmbH"
  | | |   |-Leaf of the OID tree ibadosimetry(104)   -- IBA Dosimetry GmbH
  | | |   |-Leaf of the OID tree ptw(105)   -- PTW - Freiburg Physikalisch-Technische...
  | | |   |-Leaf of the OID tree orchestra(106)   -- X-tention Informationstechnologie GmbH
  | | |   |-Leaf of the OID tree dir-ukl-hd(107)   -- Universitätsklinikum Heidelberg...
  | | |   |-Leaf of the OID tree digithurst(110)   -- DIGITHURST Bildverarbeitungssysteme...
  | | |   |-Leaf of the OID tree postbank(111)   -- Postbank Systems AG
  | | |   |-Leaf of the OID tree ulrichmedical(112)   -- Ulrich GmbH & Co. KG
  | | |   |-Leaf of the OID tree aesculap(113)   -- Aesculap AG
  | | |   |-Leaf of the OID tree fidus(114)   -- "FIDUS Software Entwicklungs-GmbH"
  | | |   |-Leaf of the OID tree qit(115)   -- "QIT Systeme GmbH & Co. KG"
  | | |   |-Leaf of the OID tree mediaire(116)   -- Mediaire GmbH
  | | |   |-Leaf of the OID tree cgmhdp(117)   -- CompuGroup Medical, Dentalsysteme GmbH
  | | |   |-Leaf of the OID tree metasystems(118)   -- MetaSystems Hard & Software GmbH
  | | |   |-Leaf of the OID tree pristem(119)   -- Pristem SA
  | | |   |-Leaf of the OID tree grade-rc(120)   -- "GRADE Reading Center"
  | | |   |-Leaf of the OID tree 121   -- TRIOVEGA GmbH
  | | |   Unfolding the subtreeNode of the OID tree offis(7230010)   -- "OFFIS" Institute for Information...
  | | |-Leaf of the OID tree 280   -- Germany (in German, Bundesrepublik Deutschland)
  | | Unfolding the subtreeNode of the OID tree gr(300)   -- Greece
  | | |-Leaf of the OID tree hk(344)   -- Hong Kong, Special Administrative Region of China
  | | Unfolding the subtreeNode of the OID tree ie(372)   -- Ireland
  | | Unfolding the subtreeNode of the OID tree jp(392)   -- Japan
  | | |-Leaf of the OID tree kz(398)   -- Kazakhstan
  | | Unfolding the subtreeNode of the OID tree kr(410)   -- Korea (the Republic of)
  | | Unfolding the subtreeNode of the OID tree md(498)   -- Moldova (Republic of)
  | | |-Leaf of the OID tree ma(504)   -- Morocco
  | | Folding the subtreeNode of the OID tree nl(528)   -- Netherlands (the)
  | | | Unfolding the subtreeNode of the OID tree nederlandse-organisatie(1)   -- Nederlandse Organisatie
  | | | Unfolding the subtreeNode of the OID tree belgium-organization(56)   -- Belgium organizations
  | | |-Leaf of the OID tree ng(566)   -- Nigeria
  | | Unfolding the subtreeNode of the OID tree no(578)   -- Norway
  | | Unfolding the subtreeNode of the OID tree pl(616)   -- Poland
  | | Unfolding the subtreeNode of the OID tree ru(643)   -- Russian Federation
  | | Unfolding the subtreeNode of the OID tree sg(702)   -- Singapore
  | | Unfolding the subtreeNode of the OID tree se(752)   -- Sweden
  | | Unfolding the subtreeNode of the OID tree ua(804)   -- Ukraine
  | | Unfolding the subtreeNode of the OID tree gb(826)   -- United Kingdom
  | | Unfolding the subtreeNode of the OID tree us(840)   -- United States of America
  | Unfolding the subtreeNode of the OID tree identified-organization(3)   -- Organization identification...
  Unfolding the subtreeNode of the OID tree joint-iso-itu-t(2) | joint-iso-ccitt(2)   -- Areas of joint work...
 
Separation line
 
Notes:
To unfold (respectively, fold) a particular level of the tree, click on an icon like Unfolding the subtree (resp., Folding the subtree).
The beginning of each OID description is displayed on the left of each arc. For a display without descriptions, please click on Undetailed tree display.
 
Disclaimer: The owner of this site does not warrant or assume any liability or responsibility for the accuracy, completeness, or usefulness of any information available on this page (for more information, please read the complete disclaimer).
All rights reserved © 2007-2025
Separation line
OID helper Webmaster Bullet 14 Feb 2025 Bullet Page top